Products 2090010-02-7
CAS 2090010-02-7 is the registry number for 2-(6-Bromo-1-methyl-1H-indazol-3-yl)acetonitrile, 95%. Offered by: Chemat. Available pack sizes: 100mg, 250mg.
2-(6-bromo-1-methylindazol-3-yl)acetonitrile (CAS 2090010-02-7) is a chemical compound with the molecular formula C10H8BrN3 and a molecular weight of 250.09 g/mol. IUPAC name: 2-(6-bromo-1-methylindazol-3-yl)acetonitrile. InChIKey: SUYRVLNPOZCTKP-UHFFFAOYSA-N.
| Molecular formula | C10H8BrN3 |
|---|---|
| Molecular weight | 250.09 g/mol |
| IUPAC name | 2-(6-bromo-1-methylindazol-3-yl)acetonitrile |
| InChIKey | SUYRVLNPOZCTKP-UHFFFAOYSA-N |
| SMILES | CN1C2=C(C=CC(=C2)Br)C(=N1)CC#N |
Computed by PubChem (NCBI)