Products 2090283-00-2
CAS 2090283-00-2 is the registry number for 2-Bromo-3-(bromomethyl)-4-fluoro-1-(trifluoromethyl)benzene, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 250mg.
3-bromo-2-(bromomethyl)-1-fluoro-4-(trifluoromethyl)benzene (CAS 2090283-00-2) is a chemical compound with the molecular formula C8H4Br2F4 and a molecular weight of 335.92 g/mol. IUPAC name: 3-bromo-2-(bromomethyl)-1-fluoro-4-(trifluoromethyl)benzene. InChIKey: ZYCNJNMSDGKDKH-UHFFFAOYSA-N.
| Molecular formula | C8H4Br2F4 |
|---|---|
| Molecular weight | 335.92 g/mol |
| IUPAC name | 3-bromo-2-(bromomethyl)-1-fluoro-4-(trifluoromethyl)benzene |
| InChIKey | ZYCNJNMSDGKDKH-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C(=C1C(F)(F)F)Br)CBr)F |
Computed by PubChem (NCBI)