Products 776-40-9
CAS 776-40-9 appears in our catalog under these names: 1，4–Bis(bromomethyl)–2，3，5，6–tetrafluorobenzene, 1,4-Bis(bromomethyl)-2,3,5,6-tetrafluorobenzene, 97%. Offered by: GLPBio, Ambeed, BLDpharm, Chemat, Fluorochem. Available pack sizes: 100mg, 250mg, 1g, 5g, 10g.
1,4-bis(bromomethyl)-2,3,5,6-tetrafluorobenzene (CAS 776-40-9) is a chemical compound with the molecular formula C8H4Br2F4 and a molecular weight of 335.92 g/mol. IUPAC name: 1,4-bis(bromomethyl)-2,3,5,6-tetrafluorobenzene. InChIKey: WTBYGXCRADGSLY-UHFFFAOYSA-N.
| Molecular formula | C8H4Br2F4 |
|---|---|
| Molecular weight | 335.92 g/mol |
| IUPAC name | 1,4-bis(bromomethyl)-2,3,5,6-tetrafluorobenzene |
| InChIKey | WTBYGXCRADGSLY-UHFFFAOYSA-N |
| SMILES | C(C1=C(C(=C(C(=C1F)F)CBr)F)F)Br |
Computed by PubChem (NCBI)