CAS 2090313-43-0 appears in our catalog under these names: (2,2,5,5-Tetramethyloxolan-3-yl)methanesulfonyl chloride, 95%, (2,2,5,5-Tetramethyloxolan-3-yl)methanesulfonyl chloride. Offered by: AmBeed, Biosynth. Available pack sizes: 1g, 0,5g, 50mg.
(2,2,5,5-tetramethyloxolan-3-yl)methanesulfonyl chloride (CAS 2090313-43-0) is a chemical compound with the molecular formula C9H17ClO3S and a molecular weight of 240.75 g/mol. IUPAC name: (2,2,5,5-tetramethyloxolan-3-yl)methanesulfonyl chloride. InChIKey: ABINJVJIJHFRMC-UHFFFAOYSA-N.
| Molecular formula | C9H17ClO3S |
|---|---|
| Molecular weight | 240.75 g/mol |
| IUPAC name | (2,2,5,5-tetramethyloxolan-3-yl)methanesulfonyl chloride |
| InChIKey | ABINJVJIJHFRMC-UHFFFAOYSA-N |
| SMILES | CC1(CC(C(O1)(C)C)CS(=O)(=O)Cl)C |
Computed by PubChem (NCBI)