CAS 2741118-78-3 is the registry number for trans-2-(Chloromethyl)cyclohexanemethanol Mesylate. Offered by: TRC. Available pack sizes: 100mg.
[(1R,2R)-2-(chloromethyl)cyclohexyl]methyl methanesulfonate (CAS 2741118-78-3) is a chemical compound with the molecular formula C9H17ClO3S and a molecular weight of 240.75 g/mol. IUPAC name: [(1R,2R)-2-(chloromethyl)cyclohexyl]methyl methanesulfonate. InChIKey: VTIPDOCBKBNXFB-IUCAKERBSA-N.
| Molecular formula | C9H17ClO3S |
|---|---|
| Molecular weight | 240.75 g/mol |
| IUPAC name | [(1R,2R)-2-(chloromethyl)cyclohexyl]methyl methanesulfonate |
| InChIKey | VTIPDOCBKBNXFB-IUCAKERBSA-N |
| SMILES | CS(=O)(=O)OC[C@@H]1CCCC[C@H]1CCl |
Computed by PubChem (NCBI)