CAS 2090370-15-1 is the registry number for 4-Aminobenzo[b]thiophene-3-carbonitrile, ≥95%, ≥95%. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 1g.
4-amino-1-benzothiophene-3-carbonitrile (CAS 2090370-15-1) is a chemical compound with the molecular formula C9H6N2S and a molecular weight of 174.22 g/mol. IUPAC name: 4-amino-1-benzothiophene-3-carbonitrile. InChIKey: LYFXMHJVOIVDDB-UHFFFAOYSA-N.
| Molecular formula | C9H6N2S |
|---|---|
| Molecular weight | 174.22 g/mol |
| IUPAC name | 4-amino-1-benzothiophene-3-carbonitrile |
| InChIKey | LYFXMHJVOIVDDB-UHFFFAOYSA-N |
| SMILES | C1=CC(=C2C(=C1)SC=C2C#N)N |
Computed by PubChem (NCBI)