CAS 63647-03-0 appears in our catalog under these names: 2-(1H-Pyrrol-1-yl)thiophene-3-carbonitrile, 95%, 2-(1H-Pyrrol-1-yl)thiophene-3-carbonitrile. Offered by: Combi-blocks, Biosynth. Available pack sizes: 1g, 100mg.
2-pyrrol-1-ylthiophene-3-carbonitrile (CAS 63647-03-0) is a chemical compound with the molecular formula C9H6N2S and a molecular weight of 174.22 g/mol. IUPAC name: 2-pyrrol-1-ylthiophene-3-carbonitrile. InChIKey: YBDDDGXQRINYPU-UHFFFAOYSA-N.
| Molecular formula | C9H6N2S |
|---|---|
| Molecular weight | 174.22 g/mol |
| IUPAC name | 2-pyrrol-1-ylthiophene-3-carbonitrile |
| InChIKey | YBDDDGXQRINYPU-UHFFFAOYSA-N |
| SMILES | C1=CN(C=C1)C2=C(C=CS2)C#N |
Computed by PubChem (NCBI)