Products 2090429-74-4
CAS 2090429-74-4 is the registry number for 4-(Cyclobutylmethyl)-1,1-dioxo-1lambda(6)-thiane-4-carboxylic acid, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 250mg, 100mg.
4-(cyclobutylmethyl)-1,1-dioxothiane-4-carboxylic acid (CAS 2090429-74-4) is a chemical compound with the molecular formula C11H18O4S and a molecular weight of 246.33 g/mol. IUPAC name: 4-(cyclobutylmethyl)-1,1-dioxothiane-4-carboxylic acid. InChIKey: CRGXYQITXMBBCD-UHFFFAOYSA-N.
| Molecular formula | C11H18O4S |
|---|---|
| Molecular weight | 246.33 g/mol |
| IUPAC name | 4-(cyclobutylmethyl)-1,1-dioxothiane-4-carboxylic acid |
| InChIKey | CRGXYQITXMBBCD-UHFFFAOYSA-N |
| SMILES | C1CC(C1)CC2(CCS(=O)(=O)CC2)C(=O)O |
Computed by PubChem (NCBI)