CAS 46471-67-4 is the registry number for Methyl (±)-10-Camphorsulfonate. Offered by: TRC. Available pack sizes: 250mg.
Methyl (7,7-dimethyl-2-oxo-1-bicyclo[2.2.1]heptanyl)methanesulfonate (CAS 46471-67-4) is a chemical compound with the molecular formula C11H18O4S and a molecular weight of 246.33 g/mol. IUPAC name: methyl (7,7-dimethyl-2-oxo-1-bicyclo[2.2.1]heptanyl)methanesulfonate. InChIKey: PIZJIRRXGXBJAU-UHFFFAOYSA-N.
| Molecular formula | C11H18O4S |
|---|---|
| Molecular weight | 246.33 g/mol |
| IUPAC name | methyl (7,7-dimethyl-2-oxo-1-bicyclo[2.2.1]heptanyl)methanesulfonate |
| InChIKey | PIZJIRRXGXBJAU-UHFFFAOYSA-N |
| SMILES | CC1(C2CCC1(C(=O)C2)CS(=O)(=O)OC)C |
Computed by PubChem (NCBI)