Products 2090531-35-2

CAS 2090531-35-2 is the registry number for 2-Methyl-5,6-dihydro-4H-pyrrolo[1,2-b]pyrazole-3-carboxylic acid, 98%. Offered by: Chemat Brand. Available pack sizes: on request.

Structural formula: {0} (CAS {1})

2-methyl-5,6-dihydro-4H-pyrrolo[2,1-e]pyrazole-3-carboxylic acid (CAS 2090531-35-2) is a chemical compound with the molecular formula C8H10N2O2 and a molecular weight of 166.18 g/mol. IUPAC name: 2-methyl-5,6-dihydro-4H-pyrrolo[2,1-e]pyrazole-3-carboxylic acid. InChIKey: OIAFISDUAFJAME-UHFFFAOYSA-N.

Identity
Molecular formulaC8H10N2O2
Molecular weight166.18 g/mol
IUPAC name2-methyl-5,6-dihydro-4H-pyrrolo[2,1-e]pyrazole-3-carboxylic acid
InChIKeyOIAFISDUAFJAME-UHFFFAOYSA-N
SMILESCC1=NN2CCCC2=C1C(=O)O

Computed by PubChem (NCBI)