Products 2090552-90-0

CAS 2090552-90-0 is the registry number for 2-Methoxy-6-methyl-3-nitrobenzoic acid, 98%. Offered by: Chemat Brand. Available pack sizes: on request.

2-methoxy-6-methyl-3-nitrobenzoic acid (CAS 2090552-90-0) is a chemical compound with the molecular formula C9H9NO5 and a molecular weight of 211.17 g/mol. IUPAC name: 2-methoxy-6-methyl-3-nitrobenzoic acid. InChIKey: KNJMWKOUHVMDIF-UHFFFAOYSA-N.

Identity
Molecular formulaC9H9NO5
Molecular weight211.17 g/mol
IUPAC name2-methoxy-6-methyl-3-nitrobenzoic acid
InChIKeyKNJMWKOUHVMDIF-UHFFFAOYSA-N
SMILESCC1=C(C(=C(C=C1)[N+](=O)[O-])OC)C(=O)O

Computed by PubChem (NCBI)