Products 2090608-24-3
CAS 2090608-24-3 is the registry number for Ethyl 4-bromo-1,3-dimethyl-1H-pyrrole-2-carboxylate, 95%. Offered by: Ambeed, BLDpharm. Available pack sizes: 100mg, 250mg, 1g.
Ethyl 4-bromo-1,3-dimethylpyrrole-2-carboxylate (CAS 2090608-24-3) is a chemical compound with the molecular formula C9H12BrNO2 and a molecular weight of 246.10 g/mol. IUPAC name: ethyl 4-bromo-1,3-dimethylpyrrole-2-carboxylate. InChIKey: XEMPKBPACTWQFA-UHFFFAOYSA-N.
| Molecular formula | C9H12BrNO2 |
|---|---|
| Molecular weight | 246.10 g/mol |
| IUPAC name | ethyl 4-bromo-1,3-dimethylpyrrole-2-carboxylate |
| InChIKey | XEMPKBPACTWQFA-UHFFFAOYSA-N |
| SMILES | CCOC(=O)C1=C(C(=CN1C)Br)C |
Computed by PubChem (NCBI)