Products 2090742-42-8

CAS 2090742-42-8 is the registry number for 2-(2-Hydroxypropan-2-yl)cyclopropane-1-carboxylic acid, 98%. Offered by: Chemat Brand. Available pack sizes: on request.

2-(2-hydroxypropan-2-yl)cyclopropane-1-carboxylic acid (CAS 2090742-42-8) is a chemical compound with the molecular formula C7H12O3 and a molecular weight of 144.17 g/mol. IUPAC name: 2-(2-hydroxypropan-2-yl)cyclopropane-1-carboxylic acid. InChIKey: TZLQEZFNTVQBII-UHFFFAOYSA-N.

Identity
Molecular formulaC7H12O3
Molecular weight144.17 g/mol
IUPAC name2-(2-hydroxypropan-2-yl)cyclopropane-1-carboxylic acid
InChIKeyTZLQEZFNTVQBII-UHFFFAOYSA-N
SMILESCC(C)(C1CC1C(=O)O)O

Computed by PubChem (NCBI)