Products 2090779-95-4

CAS 2090779-95-4 is the registry number for 1-(1H-Pyrazol-3-yl)cyclopropane-1-carboxylic acid. Offered by: Biosynth. Available pack sizes: 0,5g, 50mg.

Structural formula: {0} (CAS {1})

1-(1H-pyrazol-5-yl)cyclopropane-1-carboxylic acid (CAS 2090779-95-4) is a chemical compound with the molecular formula C7H8N2O2 and a molecular weight of 152.15 g/mol. IUPAC name: 1-(1H-pyrazol-5-yl)cyclopropane-1-carboxylic acid. InChIKey: NJAAXHOMCFVTQR-UHFFFAOYSA-N.

Identity
Molecular formulaC7H8N2O2
Molecular weight152.15 g/mol
IUPAC name1-(1H-pyrazol-5-yl)cyclopropane-1-carboxylic acid
InChIKeyNJAAXHOMCFVTQR-UHFFFAOYSA-N
SMILESC1CC1(C2=CC=NN2)C(=O)O

Computed by PubChem (NCBI)