CAS 2090924-44-8 is the registry number for methyl 3-bromo-[1,2,4]triazolo[4,3-a]pyridine-6-carboxylate, 95%, 95%. Offered by: Chemat. Available pack sizes: 100mg, 250mg.
Methyl 3-bromo-[1,2,4]triazolo[4,3-a]pyridine-6-carboxylate (CAS 2090924-44-8) is a chemical compound with the molecular formula C8H6BrN3O2 and a molecular weight of 256.06 g/mol. IUPAC name: methyl 3-bromo-[1,2,4]triazolo[4,3-a]pyridine-6-carboxylate. InChIKey: FGGFQTPYIMFQHL-UHFFFAOYSA-N.
| Molecular formula | C8H6BrN3O2 |
|---|---|
| Molecular weight | 256.06 g/mol |
| IUPAC name | methyl 3-bromo-[1,2,4]triazolo[4,3-a]pyridine-6-carboxylate |
| InChIKey | FGGFQTPYIMFQHL-UHFFFAOYSA-N |
| SMILES | COC(=O)C1=CN2C(=NN=C2Br)C=C1 |
Computed by PubChem (NCBI)