Products 2091029-59-1
CAS 2091029-59-1 is the registry number for methyl 6-chloro-2-fluoro-3-iodobenzoate, ≥95%, ≥95%. Offered by: Chemat. Available pack sizes: 1g.
Methyl 6-chloro-2-fluoro-3-iodobenzoate (CAS 2091029-59-1) is a chemical compound with the molecular formula C8H5ClFIO2 and a molecular weight of 314.48 g/mol. IUPAC name: methyl 6-chloro-2-fluoro-3-iodobenzoate. InChIKey: ZSNXMKYEEBTCDP-UHFFFAOYSA-N.
| Molecular formula | C8H5ClFIO2 |
|---|---|
| Molecular weight | 314.48 g/mol |
| IUPAC name | methyl 6-chloro-2-fluoro-3-iodobenzoate |
| InChIKey | ZSNXMKYEEBTCDP-UHFFFAOYSA-N |
| SMILES | COC(=O)C1=C(C=CC(=C1F)I)Cl |
Computed by PubChem (NCBI)