CAS 2091049-26-0 is the registry number for 8-Bromo-[1,2,4]triazolo[1,5-a]pyridine-2-carbonitrile, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
8-bromo-[1,2,4]triazolo[1,5-a]pyridine-2-carbonitrile (CAS 2091049-26-0) is a chemical compound with the molecular formula C7H3BrN4 and a molecular weight of 223.03 g/mol. IUPAC name: 8-bromo-[1,2,4]triazolo[1,5-a]pyridine-2-carbonitrile. InChIKey: CJQIOCOQAHFWEQ-UHFFFAOYSA-N.
| Molecular formula | C7H3BrN4 |
|---|---|
| Molecular weight | 223.03 g/mol |
| IUPAC name | 8-bromo-[1,2,4]triazolo[1,5-a]pyridine-2-carbonitrile |
| InChIKey | CJQIOCOQAHFWEQ-UHFFFAOYSA-N |
| SMILES | C1=CN2C(=NC(=N2)C#N)C(=C1)Br |
Computed by PubChem (NCBI)