CAS 2781103-38-4 is the registry number for 5-Bromo-7H-pyrrolo[2,3-d]pyrimidine-2-carbonitrile, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
5-bromo-7H-pyrrolo[2,3-d]pyrimidine-2-carbonitrile (CAS 2781103-38-4) is a chemical compound with the molecular formula C7H3BrN4 and a molecular weight of 223.03 g/mol. IUPAC name: 5-bromo-7H-pyrrolo[2,3-d]pyrimidine-2-carbonitrile. InChIKey: TXTHFNWHWVMMBV-UHFFFAOYSA-N.
| Molecular formula | C7H3BrN4 |
|---|---|
| Molecular weight | 223.03 g/mol |
| IUPAC name | 5-bromo-7H-pyrrolo[2,3-d]pyrimidine-2-carbonitrile |
| InChIKey | TXTHFNWHWVMMBV-UHFFFAOYSA-N |
| SMILES | C1=C(C2=CN=C(N=C2N1)C#N)Br |
Computed by PubChem (NCBI)