Products 2091573-19-0

CAS 2091573-19-0 is the registry number for 2-(1,4-Dioxan-2-yl)ethane-1-sulfonyl chloride. Offered by: Biosynth. Available pack sizes: 50mg, 0,5g.

Structural formula: {0} (CAS {1})

2-(1,4-dioxan-2-yl)ethanesulfonyl chloride (CAS 2091573-19-0) is a chemical compound with the molecular formula C6H11ClO4S and a molecular weight of 214.67 g/mol. IUPAC name: 2-(1,4-dioxan-2-yl)ethanesulfonyl chloride. InChIKey: VGHNTASRZCVPIN-UHFFFAOYSA-N.

Identity
Molecular formulaC6H11ClO4S
Molecular weight214.67 g/mol
IUPAC name2-(1,4-dioxan-2-yl)ethanesulfonyl chloride
InChIKeyVGHNTASRZCVPIN-UHFFFAOYSA-N
SMILESC1COC(CO1)CCS(=O)(=O)Cl

Computed by PubChem (NCBI)