Products 2091807-48-4

CAS 2091807-48-4 is the registry number for Methyl 3-(chlorosulfonyl)-2-methylbutanoate. Offered by: Biosynth. Available pack sizes: 50mg, 0,5g.

Structural formula: {0} (CAS {1})

Methyl 3-chlorosulfonyl-2-methylbutanoate (CAS 2091807-48-4) is a chemical compound with the molecular formula C6H11ClO4S and a molecular weight of 214.67 g/mol. IUPAC name: methyl 3-chlorosulfonyl-2-methylbutanoate. InChIKey: FVMAVFNTQZIDFC-UHFFFAOYSA-N.

Identity
Molecular formulaC6H11ClO4S
Molecular weight214.67 g/mol
IUPAC namemethyl 3-chlorosulfonyl-2-methylbutanoate
InChIKeyFVMAVFNTQZIDFC-UHFFFAOYSA-N
SMILESCC(C(C)S(=O)(=O)Cl)C(=O)OC

Computed by PubChem (NCBI)