CAS 2091582-24-8 is the registry number for 5-Bromo-2-nitrobenzene-1,3-diamine, 95%, 95%. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g.
5-bromo-2-nitrobenzene-1,3-diamine (CAS 2091582-24-8) is a chemical compound with the molecular formula C6H6BrN3O2 and a molecular weight of 232.03 g/mol. IUPAC name: 5-bromo-2-nitrobenzene-1,3-diamine. InChIKey: BZYFEDNLPOUVBQ-UHFFFAOYSA-N.
| Molecular formula | C6H6BrN3O2 |
|---|---|
| Molecular weight | 232.03 g/mol |
| IUPAC name | 5-bromo-2-nitrobenzene-1,3-diamine |
| InChIKey | BZYFEDNLPOUVBQ-UHFFFAOYSA-N |
| SMILES | C1=C(C=C(C(=C1N)[N+](=O)[O-])N)Br |
Computed by PubChem (NCBI)