CAS 2091705-41-6 is the registry number for 2,2-Difluoro-3-(trifluoromethyl)cyclopropane-1-carboxylic Acid. Offered by: TRC. Available pack sizes: 100mg.
2,2-difluoro-3-(trifluoromethyl)cyclopropane-1-carboxylic acid (CAS 2091705-41-6) is a chemical compound with the molecular formula C5H3F5O2 and a molecular weight of 190.07 g/mol. IUPAC name: 2,2-difluoro-3-(trifluoromethyl)cyclopropane-1-carboxylic acid. InChIKey: FVPDZSRCKUZFLZ-UHFFFAOYSA-N.
| Molecular formula | C5H3F5O2 |
|---|---|
| Molecular weight | 190.07 g/mol |
| IUPAC name | 2,2-difluoro-3-(trifluoromethyl)cyclopropane-1-carboxylic acid |
| InChIKey | FVPDZSRCKUZFLZ-UHFFFAOYSA-N |
| SMILES | C1(C(C1(F)F)C(F)(F)F)C(=O)O |
Computed by PubChem (NCBI)