Products 53841-58-0
CAS 53841-58-0 is the registry number for 2-(Pentafluoropropenyl)acetate, 95%. Offered by: Combi-blocks. Available pack sizes: 5g, 25g, 1g.
(E)-3,4,5,5,5-pentafluoropent-3-enoic acid (CAS 53841-58-0) is a chemical compound with the molecular formula C5H3F5O2 and a molecular weight of 190.07 g/mol. IUPAC name: (E)-3,4,5,5,5-pentafluoropent-3-enoic acid. InChIKey: LXLSCUIGXWSTAC-DUXPYHPUSA-N.
| Molecular formula | C5H3F5O2 |
|---|---|
| Molecular weight | 190.07 g/mol |
| IUPAC name | (E)-3,4,5,5,5-pentafluoropent-3-enoic acid |
| InChIKey | LXLSCUIGXWSTAC-DUXPYHPUSA-N |
| SMILES | C(/C(=C(/C(F)(F)F)\F)/F)C(=O)O |
Computed by PubChem (NCBI)