CAS 2091906-33-9 is the registry number for rac-(2R,3R)-3-Methyl-1,4-dioxane-2-carboxylic acid. Offered by: Biosynth. Available pack sizes: 50mg, 0,5g.
(2S,3S)-3-methyl-1,4-dioxane-2-carboxylic acid (CAS 2091906-33-9) is a chemical compound with the molecular formula C6H10O4 and a molecular weight of 146.14 g/mol. IUPAC name: (2S,3S)-3-methyl-1,4-dioxane-2-carboxylic acid. InChIKey: ORABVXWUIHLPPW-WHFBIAKZSA-N.
| Molecular formula | C6H10O4 |
|---|---|
| Molecular weight | 146.14 g/mol |
| IUPAC name | (2S,3S)-3-methyl-1,4-dioxane-2-carboxylic acid |
| InChIKey | ORABVXWUIHLPPW-WHFBIAKZSA-N |
| SMILES | C[C@H]1[C@H](OCCO1)C(=O)O |
Computed by PubChem (NCBI)