Products 2092066-24-3
CAS 2092066-24-3 is the registry number for 5-Oxo-octahydroindolizine-8a-carboxylic acid. Offered by: Biosynth. Available pack sizes: 0,5g, 50mg.
5-oxo-1,2,3,6,7,8-hexahydroindolizine-8a-carboxylic acid (CAS 2092066-24-3) is a chemical compound with the molecular formula C9H13NO3 and a molecular weight of 183.20 g/mol. IUPAC name: 5-oxo-1,2,3,6,7,8-hexahydroindolizine-8a-carboxylic acid. InChIKey: VSKYYRSDOPUNSG-UHFFFAOYSA-N.
| Molecular formula | C9H13NO3 |
|---|---|
| Molecular weight | 183.20 g/mol |
| IUPAC name | 5-oxo-1,2,3,6,7,8-hexahydroindolizine-8a-carboxylic acid |
| InChIKey | VSKYYRSDOPUNSG-UHFFFAOYSA-N |
| SMILES | C1CC(=O)N2CCCC2(C1)C(=O)O |
Computed by PubChem (NCBI)