CAS 2092211-77-1 is the registry number for 6-Bromo-2-(chloromethyl)-(1,2,4)triazolo(1,5-a)pyrimidine. Offered by: Biosynth. Available pack sizes: 0,5g, 50mg.
6-bromo-2-(chloromethyl)-[1,2,4]triazolo[1,5-a]pyrimidine (CAS 2092211-77-1) is a chemical compound with the molecular formula C6H4BrClN4 and a molecular weight of 247.48 g/mol. IUPAC name: 6-bromo-2-(chloromethyl)-[1,2,4]triazolo[1,5-a]pyrimidine. InChIKey: YFYRIUGUAOWWDU-UHFFFAOYSA-N.
| Molecular formula | C6H4BrClN4 |
|---|---|
| Molecular weight | 247.48 g/mol |
| IUPAC name | 6-bromo-2-(chloromethyl)-[1,2,4]triazolo[1,5-a]pyrimidine |
| InChIKey | YFYRIUGUAOWWDU-UHFFFAOYSA-N |
| SMILES | C1=C(C=NC2=NC(=NN21)CCl)Br |
Computed by PubChem (NCBI)