CAS 2768550-08-7 is the registry number for 7-Bromo-3-chloropyrazolo[1,5-a]pyrazin-4-amine, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
7-bromo-3-chloropyrazolo[1,5-a]pyrazin-4-amine (CAS 2768550-08-7) is a chemical compound with the molecular formula C6H4BrClN4 and a molecular weight of 247.48 g/mol. IUPAC name: 7-bromo-3-chloropyrazolo[1,5-a]pyrazin-4-amine. InChIKey: BKVIJFPMMSJLOS-UHFFFAOYSA-N.
| Molecular formula | C6H4BrClN4 |
|---|---|
| Molecular weight | 247.48 g/mol |
| IUPAC name | 7-bromo-3-chloropyrazolo[1,5-a]pyrazin-4-amine |
| InChIKey | BKVIJFPMMSJLOS-UHFFFAOYSA-N |
| SMILES | C1=C(N2C(=C(C=N2)Cl)C(=N1)N)Br |
Computed by PubChem (NCBI)