Products 2092336-57-5
CAS 2092336-57-5 is the registry number for 1-(2-Methoxyethyl)-5-(trifluoromethyl)-1h-pyrazole-3-carboxylic acid, 95%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 1g, 100mg, 250mg.
1-(2-methoxyethyl)-5-(trifluoromethyl)pyrazole-3-carboxylic acid (CAS 2092336-57-5) is a chemical compound with the molecular formula C8H9F3N2O3 and a molecular weight of 238.16 g/mol. IUPAC name: 1-(2-methoxyethyl)-5-(trifluoromethyl)pyrazole-3-carboxylic acid. InChIKey: KSUPDAYBQXYNNA-UHFFFAOYSA-N.
| Molecular formula | C8H9F3N2O3 |
|---|---|
| Molecular weight | 238.16 g/mol |
| IUPAC name | 1-(2-methoxyethyl)-5-(trifluoromethyl)pyrazole-3-carboxylic acid |
| InChIKey | KSUPDAYBQXYNNA-UHFFFAOYSA-N |
| SMILES | COCCN1C(=CC(=N1)C(=O)O)C(F)(F)F |
Computed by PubChem (NCBI)