CAS 2821786-27-8 is the registry number for 1-Methyl-3-(2,2,2-trifluoro-1-methoxyethyl)-1H-pyrazole-5-carboxylic acid, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
1-methyl-3-(2,2,2-trifluoro-1-methoxyethyl)pyrazole-5-carboxylic acid (CAS 2821786-27-8) is a chemical compound with the molecular formula C8H9F3N2O3 and a molecular weight of 238.16 g/mol. IUPAC name: 1-methyl-3-(2,2,2-trifluoro-1-methoxyethyl)pyrazole-5-carboxylic acid. InChIKey: YUBJTBBRQCRCKO-UHFFFAOYSA-N.
| Molecular formula | C8H9F3N2O3 |
|---|---|
| Molecular weight | 238.16 g/mol |
| IUPAC name | 1-methyl-3-(2,2,2-trifluoro-1-methoxyethyl)pyrazole-5-carboxylic acid |
| InChIKey | YUBJTBBRQCRCKO-UHFFFAOYSA-N |
| SMILES | CN1C(=CC(=N1)C(C(F)(F)F)OC)C(=O)O |
Computed by PubChem (NCBI)