Products 2092415-35-3

CAS 2092415-35-3 appears in our catalog under these names: 2,8-Dioxaspiro(4.5)decane-1,4-dione, 95%, 2,8-Dioxaspiro(4.5)decane-1,4-dione. Offered by: AmBeed, Biosynth. Available pack sizes: 1g, 0,5g, 50mg.

Structural formula: {0} (CAS {1})

2,8-dioxaspiro[4.5]decane-1,4-dione (CAS 2092415-35-3) is a chemical compound with the molecular formula C8H10O4 and a molecular weight of 170.16 g/mol. IUPAC name: 2,8-dioxaspiro[4.5]decane-1,4-dione. InChIKey: SKUIGYKVHGGEIF-UHFFFAOYSA-N.

Identity
Molecular formulaC8H10O4
Molecular weight170.16 g/mol
IUPAC name2,8-dioxaspiro[4.5]decane-1,4-dione
InChIKeySKUIGYKVHGGEIF-UHFFFAOYSA-N
SMILESC1COCCC12C(=O)COC2=O

Computed by PubChem (NCBI)