CAS 2092424-29-6 appears in our catalog under these names: 8-Bromo-7-chloroisoquinoline, 98%, 8-Bromo-7-chloroisoquinoline. Offered by: AmBeed, Biosynth. Available pack sizes: 1g, 100mg, 50mg, 250mg, 500mg, 1000mg.
8-bromo-7-chloroisoquinoline (CAS 2092424-29-6) is a chemical compound with the molecular formula C9H5BrClN and a molecular weight of 242.50 g/mol. IUPAC name: 8-bromo-7-chloroisoquinoline. InChIKey: UDZWYGYMAXQFFC-UHFFFAOYSA-N.
| Molecular formula | C9H5BrClN |
|---|---|
| Molecular weight | 242.50 g/mol |
| IUPAC name | 8-bromo-7-chloroisoquinoline |
| InChIKey | UDZWYGYMAXQFFC-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C2=C1C=CN=C2)Br)Cl |
Computed by PubChem (NCBI)