CAS 20926-81-2 is the registry number for 2-(3-benzo(3,4-d)1,3-dioxolen-5-ylprop-2-enoyl)indane-1,3-dione. Offered by: Biosynth. Available pack sizes: 250mg.
2-[(E)-3-(1,3-benzodioxol-5-yl)prop-2-enoyl]indene-1,3-dione (CAS 20926-81-2) is a chemical compound with the molecular formula C19H12O5 and a molecular weight of 320.3 g/mol. IUPAC name: 2-[(E)-3-(1,3-benzodioxol-5-yl)prop-2-enoyl]indene-1,3-dione. InChIKey: BVIXXTXWWWACNQ-FNORWQNLSA-N.
| Molecular formula | C19H12O5 |
|---|---|
| Molecular weight | 320.3 g/mol |
| IUPAC name | 2-[(E)-3-(1,3-benzodioxol-5-yl)prop-2-enoyl]indene-1,3-dione |
| InChIKey | BVIXXTXWWWACNQ-FNORWQNLSA-N |
| SMILES | C1OC2=C(O1)C=C(C=C2)/C=C/C(=O)C3C(=O)C4=CC=CC=C4C3=O |
Computed by PubChem (NCBI)