CAS 93908-33-9 is the registry number for 4-Hydroxyphlebiarubrone. Offered by: MedChemExpress. Available pack sizes: Get quote.
4-(4-hydroxyphenyl)-7-phenyl-1,3-benzodioxole-5,6-dione (CAS 93908-33-9) is a chemical compound with the molecular formula C19H12O5 and a molecular weight of 320.3 g/mol. IUPAC name: 4-(4-hydroxyphenyl)-7-phenyl-1,3-benzodioxole-5,6-dione. InChIKey: FRYSCMBOMJBOPS-UHFFFAOYSA-N.
| Molecular formula | C19H12O5 |
|---|---|
| Molecular weight | 320.3 g/mol |
| IUPAC name | 4-(4-hydroxyphenyl)-7-phenyl-1,3-benzodioxole-5,6-dione |
| InChIKey | FRYSCMBOMJBOPS-UHFFFAOYSA-N |
| SMILES | C1OC2=C(C(=O)C(=O)C(=C2O1)C3=CC=C(C=C3)O)C4=CC=CC=C4 |
Computed by PubChem (NCBI)