Products 2092788-67-3
CAS 2092788-67-3 appears in our catalog under these names: 4–Chloro–2–methyl–6–(trifluoromethyl)pyrido(3，2–d)pyrimidine, 4-Chloro-2-methyl-6-(trifluoromethyl)pyrido[3,2-d]pyrimidine, 95%. Offered by: GLPBio, Ambeed. Available pack sizes: 50mg, 1g, 250mg, 100mg.
4-chloro-2-methyl-6-(trifluoromethyl)pyrido[3,2-d]pyrimidine (CAS 2092788-67-3) is a chemical compound with the molecular formula C9H5ClF3N3 and a molecular weight of 247.60 g/mol. IUPAC name: 4-chloro-2-methyl-6-(trifluoromethyl)pyrido[3,2-d]pyrimidine. InChIKey: IOWWCGDFALMXSC-UHFFFAOYSA-N.
| Molecular formula | C9H5ClF3N3 |
|---|---|
| Molecular weight | 247.60 g/mol |
| IUPAC name | 4-chloro-2-methyl-6-(trifluoromethyl)pyrido[3,2-d]pyrimidine |
| InChIKey | IOWWCGDFALMXSC-UHFFFAOYSA-N |
| SMILES | CC1=NC2=C(C(=N1)Cl)N=C(C=C2)C(F)(F)F |
Computed by PubChem (NCBI)