CAS 438450-38-5 appears in our catalog under these names: 3-Chloro-2-(3-(trifluoromethyl)-1h-pyrazol-1-yl)pyridine, 95%, 3–chloro–2–(3–(trifluoromethyl)–1H–pyrazol–1–yl)pyridine. Offered by: Combi-blocks, GLPBio. Available pack sizes: 250mg, 1g.
3-chloro-2-[3-(trifluoromethyl)pyrazol-1-yl]pyridine (CAS 438450-38-5) is a chemical compound with the molecular formula C9H5ClF3N3 and a molecular weight of 247.60 g/mol. IUPAC name: 3-chloro-2-[3-(trifluoromethyl)pyrazol-1-yl]pyridine. InChIKey: IADZROUQPRNNNZ-UHFFFAOYSA-N.
| Molecular formula | C9H5ClF3N3 |
|---|---|
| Molecular weight | 247.60 g/mol |
| IUPAC name | 3-chloro-2-[3-(trifluoromethyl)pyrazol-1-yl]pyridine |
| InChIKey | IADZROUQPRNNNZ-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(N=C1)N2C=CC(=N2)C(F)(F)F)Cl |
Computed by PubChem (NCBI)