CAS 2093433-63-5 appears in our catalog under these names: 2'-Oxo-1',2'-dihydrospiro[cyclopropane-1,3'-indole]-5'-carbonitrile, 95%, 2'-oxo-1',2'-dihydrospiro[cyclopropane-1,3'-indole]-5'-carbonitrile, 95%, 95%. Offered by: Combi-blocks, Chemat, Fluorochem. Available pack sizes: 250mg, 1g, 100mg, 500mg.
2-oxospiro[1H-indole-3,1'-cyclopropane]-5-carbonitrile (CAS 2093433-63-5) is a chemical compound with the molecular formula C11H8N2O and a molecular weight of 184.19 g/mol. IUPAC name: 2-oxospiro[1H-indole-3,1'-cyclopropane]-5-carbonitrile. InChIKey: JIDKODOLBDHNQC-UHFFFAOYSA-N.
| Molecular formula | C11H8N2O |
|---|---|
| Molecular weight | 184.19 g/mol |
| IUPAC name | 2-oxospiro[1H-indole-3,1'-cyclopropane]-5-carbonitrile |
| InChIKey | JIDKODOLBDHNQC-UHFFFAOYSA-N |
| SMILES | C1CC12C3=C(C=CC(=C3)C#N)NC2=O |
Computed by PubChem (NCBI)