CAS 2093702-63-5 is the registry number for 3-(Piperidin-3-yl)-1H-pyrazole-4-carboxamide hydrochloride, 95%. Offered by: AmBeed. Available pack sizes: 1g.
5-piperidin-3-yl-1H-pyrazole-4-carboxamide;hydrochloride (CAS 2093702-63-5) is a chemical compound with the molecular formula C9H15ClN4O and a molecular weight of 230.69 g/mol. IUPAC name: 5-piperidin-3-yl-1H-pyrazole-4-carboxamide;hydrochloride. InChIKey: PTFJXTKNLDBWHJ-UHFFFAOYSA-N.
| Molecular formula | C9H15ClN4O |
|---|---|
| Molecular weight | 230.69 g/mol |
| IUPAC name | 5-piperidin-3-yl-1H-pyrazole-4-carboxamide;hydrochloride |
| InChIKey | PTFJXTKNLDBWHJ-UHFFFAOYSA-N |
| SMILES | C1CC(CNC1)C2=C(C=NN2)C(=O)N.Cl |
Computed by PubChem (NCBI)