Products 1029634-15-8
CAS 1029634-15-8 is the registry number for 2-[(5-Methylpyrazine-2-carbonyl)amino]propylaminehydrochloride, 97%. Offered by: Fluorochem. Available pack sizes: 1g, 5g.
3-[(5-methylpyrazine-2-carbonyl)amino]propylazanium chloride (CAS 1029634-15-8) is a chemical compound with the molecular formula C9H15ClN4O and a molecular weight of 230.69 g/mol. IUPAC name: 3-[(5-methylpyrazine-2-carbonyl)amino]propylazanium chloride. InChIKey: CRJXWNVWLUMXBA-UHFFFAOYSA-N.
| Molecular formula | C9H15ClN4O |
|---|---|
| Molecular weight | 230.69 g/mol |
| IUPAC name | 3-[(5-methylpyrazine-2-carbonyl)amino]propylazanium chloride |
| InChIKey | CRJXWNVWLUMXBA-UHFFFAOYSA-N |
| SMILES | CC1=CN=C(C=N1)C(=O)NCCC[NH3+].[Cl-] |
Computed by PubChem (NCBI)