CAS 2094-99-7 appears in our catalog under these names: 3-Isopropenyl-alpha,alpha-dimethylbenzylisocyanate, 98%, 3–Isopropenyl–α,α–dimethylbenzyl isocyanate, 3-Isopropenyl-alpha,alpha-dimethylbenzyl, 3-Isopropenyl-alpha,alpha-dimethylbenzyl Isocyanate, >95.0%(GC). Offered by: Chemat Brand, GLPBio, TargetMol, TCI, Sigma-Aldrich. Available pack sizes: on request, 100ml, 25ml, 5mg, 10mg, 25mg, 50mg, 100mg.
1-(2-isocyanatopropan-2-yl)-3-prop-1-en-2-ylbenzene (CAS 2094-99-7) is a chemical compound with the molecular formula C13H15NO and a molecular weight of 201.26 g/mol. IUPAC name: 1-(2-isocyanatopropan-2-yl)-3-prop-1-en-2-ylbenzene. InChIKey: ZVEMLYIXBCTVOF-UHFFFAOYSA-N.
| Molecular formula | C13H15NO |
|---|---|
| Molecular weight | 201.26 g/mol |
| IUPAC name | 1-(2-isocyanatopropan-2-yl)-3-prop-1-en-2-ylbenzene |
| InChIKey | ZVEMLYIXBCTVOF-UHFFFAOYSA-N |
| SMILES | CC(=C)C1=CC(=CC=C1)C(C)(C)N=C=O |
Computed by PubChem (NCBI)