Products 2094028-78-9
CAS 2094028-78-9 appears in our catalog under these names: (2R,3S)-1-(((9H-Fluoren-9-yl)methoxy)carbonyl)-2-phenylpyrrolidine-3-carboxylic acid, 95%, 95%, (2R,3S)-1-Fmoc-2-phenylpyrrolidine-3-carboxylic acid, 95%. Offered by: Chemat, Ambeed. Available pack sizes: 50mg, 100mg, 250mg, 1g.
(2R,3S)-1-(9H-fluoren-9-ylmethoxycarbonyl)-2-phenylpyrrolidine-3-carboxylic acid (CAS 2094028-78-9) is a chemical compound with the molecular formula C26H23NO4 and a molecular weight of 413.5 g/mol. IUPAC name: (2R,3S)-1-(9H-fluoren-9-ylmethoxycarbonyl)-2-phenylpyrrolidine-3-carboxylic acid. InChIKey: ZCRFRBRGTNYAKX-UPVQGACJSA-N.
| Molecular formula | C26H23NO4 |
|---|---|
| Molecular weight | 413.5 g/mol |
| IUPAC name | (2R,3S)-1-(9H-fluoren-9-ylmethoxycarbonyl)-2-phenylpyrrolidine-3-carboxylic acid |
| InChIKey | ZCRFRBRGTNYAKX-UPVQGACJSA-N |
| SMILES | C1CN([C@H]([C@H]1C(=O)O)C2=CC=CC=C2)C(=O)OCC3C4=CC=CC=C4C5=CC=CC=C35 |
Computed by PubChem (NCBI)