Products 2094319-46-5
CAS 2094319-46-5 is the registry number for 1-(Aminomethyl)-N,N-dimethylcyclopropane-1-sulfonamide hydrochloride. Offered by: Biosynth. Available pack sizes: 50mg, 0,5g.
1-(aminomethyl)-N,N-dimethylcyclopropane-1-sulfonamide;hydrochloride (CAS 2094319-46-5) is a chemical compound with the molecular formula C6H15ClN2O2S and a molecular weight of 214.71 g/mol. IUPAC name: 1-(aminomethyl)-N,N-dimethylcyclopropane-1-sulfonamide;hydrochloride. InChIKey: IVSRUUXRKNYYRM-UHFFFAOYSA-N.
| Molecular formula | C6H15ClN2O2S |
|---|---|
| Molecular weight | 214.71 g/mol |
| IUPAC name | 1-(aminomethyl)-N,N-dimethylcyclopropane-1-sulfonamide;hydrochloride |
| InChIKey | IVSRUUXRKNYYRM-UHFFFAOYSA-N |
| SMILES | CN(C)S(=O)(=O)C1(CC1)CN.Cl |
Computed by PubChem (NCBI)