CAS 2094379-52-7 is the registry number for 1-(2-Aminoethyl)-2,4-dioxo-1,2,3,4-tetrahydropyrimidine-5-carboxylic acid hydrochloride, 95%. Offered by: AmBeed. Available pack sizes: 1g.
1-(2-aminoethyl)-2,4-dioxopyrimidine-5-carboxylic acid;hydrochloride (CAS 2094379-52-7) is a chemical compound with the molecular formula C7H10ClN3O4 and a molecular weight of 235.62 g/mol. IUPAC name: 1-(2-aminoethyl)-2,4-dioxopyrimidine-5-carboxylic acid;hydrochloride. InChIKey: XKSUAICOBCHUNL-UHFFFAOYSA-N.
| Molecular formula | C7H10ClN3O4 |
|---|---|
| Molecular weight | 235.62 g/mol |
| IUPAC name | 1-(2-aminoethyl)-2,4-dioxopyrimidine-5-carboxylic acid;hydrochloride |
| InChIKey | XKSUAICOBCHUNL-UHFFFAOYSA-N |
| SMILES | C1=C(C(=O)NC(=O)N1CCN)C(=O)O.Cl |
Computed by PubChem (NCBI)