CAS 2094419-41-5 is the registry number for 3-(2-Chlorophenyl)-2,2-dimethylpyrrolidine hydrochloride. Offered by: Biosynth. Available pack sizes: 50mg, 0,5g.
3-(2-chlorophenyl)-2,2-dimethylpyrrolidine;hydrochloride (CAS 2094419-41-5) is a chemical compound with the molecular formula C12H17Cl2N and a molecular weight of 246.17 g/mol. IUPAC name: 3-(2-chlorophenyl)-2,2-dimethylpyrrolidine;hydrochloride. InChIKey: BQGBZNBUUBUOGC-UHFFFAOYSA-N.
| Molecular formula | C12H17Cl2N |
|---|---|
| Molecular weight | 246.17 g/mol |
| IUPAC name | 3-(2-chlorophenyl)-2,2-dimethylpyrrolidine;hydrochloride |
| InChIKey | BQGBZNBUUBUOGC-UHFFFAOYSA-N |
| SMILES | CC1(C(CCN1)C2=CC=CC=C2Cl)C.Cl |
Computed by PubChem (NCBI)