CAS 2094920-12-2 is the registry number for tert-Butyl 4-(5-amino-1H-1,3-benzodiazol-2-yl)piperidine-1-carboxylate. Offered by: Biosynth. Available pack sizes: 50mg, 0,5g.
Tert-butyl 4-(6-amino-1H-benzimidazol-2-yl)piperidine-1-carboxylate (CAS 2094920-12-2) is a chemical compound with the molecular formula C17H24N4O2 and a molecular weight of 316.4 g/mol. IUPAC name: tert-butyl 4-(6-amino-1H-benzimidazol-2-yl)piperidine-1-carboxylate. InChIKey: TWNXYYYWFQSZCH-UHFFFAOYSA-N.
| Molecular formula | C17H24N4O2 |
|---|---|
| Molecular weight | 316.4 g/mol |
| IUPAC name | tert-butyl 4-(6-amino-1H-benzimidazol-2-yl)piperidine-1-carboxylate |
| InChIKey | TWNXYYYWFQSZCH-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)N1CCC(CC1)C2=NC3=C(N2)C=C(C=C3)N |
Computed by PubChem (NCBI)