CAS 860151-85-5 is the registry number for 2,6-Bis((S)-4-isopropyl-4,5-dihydrooxazol-2-yl)pyridin-4-amine, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
2,6-bis[(4S)-4-propan-2-yl-4,5-dihydro-1,3-oxazol-2-yl]pyridin-4-amine (CAS 860151-85-5) is a chemical compound with the molecular formula C17H24N4O2 and a molecular weight of 316.4 g/mol. IUPAC name: 2,6-bis[(4S)-4-propan-2-yl-4,5-dihydro-1,3-oxazol-2-yl]pyridin-4-amine. InChIKey: HMXPXPJUJKWCDR-HUUCEWRRSA-N.
| Molecular formula | C17H24N4O2 |
|---|---|
| Molecular weight | 316.4 g/mol |
| IUPAC name | 2,6-bis[(4S)-4-propan-2-yl-4,5-dihydro-1,3-oxazol-2-yl]pyridin-4-amine |
| InChIKey | HMXPXPJUJKWCDR-HUUCEWRRSA-N |
| SMILES | CC(C)[C@H]1COC(=N1)C2=CC(=CC(=N2)C3=N[C@H](CO3)C(C)C)N |
Computed by PubChem (NCBI)