CAS 2095396-89-5 is the registry number for (2R)-1-(1-Methyl-1H-1,2,3-triazol-4-yl)propan-2-amine dihydrochloride, 95%. Offered by: AmBeed. Available pack sizes: 1g.
(2R)-1-(1-methyltriazol-4-yl)propan-2-amine;dihydrochloride (CAS 2095396-89-5) is a chemical compound with the molecular formula C6H14Cl2N4 and a molecular weight of 213.11 g/mol. IUPAC name: (2R)-1-(1-methyltriazol-4-yl)propan-2-amine;dihydrochloride. InChIKey: IFTHGLAEHAAHAI-ZJIMSODOSA-N.
| Molecular formula | C6H14Cl2N4 |
|---|---|
| Molecular weight | 213.11 g/mol |
| IUPAC name | (2R)-1-(1-methyltriazol-4-yl)propan-2-amine;dihydrochloride |
| InChIKey | IFTHGLAEHAAHAI-ZJIMSODOSA-N |
| SMILES | C[C@H](CC1=CN(N=N1)C)N.Cl.Cl |
Computed by PubChem (NCBI)