Products 2095409-70-2

CAS 2095409-70-2 is the registry number for Moxifloxacin Impurity 80 DiHCl. Offered by: Chemat Brand. Available pack sizes: on request.

Structural formula: {0} (CAS {1})

2,3,3a,4,5,6,7,7a-octahydro-1H-pyrrolo[3,2-b]pyridine;dihydrochloride (CAS 2095409-70-2) is a chemical compound with the molecular formula C7H16Cl2N2 and a molecular weight of 199.12 g/mol. IUPAC name: 2,3,3a,4,5,6,7,7a-octahydro-1H-pyrrolo[3,2-b]pyridine;dihydrochloride. InChIKey: MPZAUAZQMGVPOG-UHFFFAOYSA-N.

Identity
Molecular formulaC7H16Cl2N2
Molecular weight199.12 g/mol
IUPAC name2,3,3a,4,5,6,7,7a-octahydro-1H-pyrrolo[3,2-b]pyridine;dihydrochloride
InChIKeyMPZAUAZQMGVPOG-UHFFFAOYSA-N
SMILESC1CC2C(CCN2)NC1.Cl.Cl

Computed by PubChem (NCBI)