Products 2095410-29-8
CAS 2095410-29-8 is the registry number for (6,6-Dimethyloxan-2-yl)methanesulfonamide. Offered by: Biosynth. Available pack sizes: 0,5g, 50mg.
(6,6-dimethyloxan-2-yl)methanesulfonamide (CAS 2095410-29-8) is a chemical compound with the molecular formula C8H17NO3S and a molecular weight of 207.29 g/mol. IUPAC name: (6,6-dimethyloxan-2-yl)methanesulfonamide. InChIKey: WEWPFVFKNZUSLM-UHFFFAOYSA-N.
| Molecular formula | C8H17NO3S |
|---|---|
| Molecular weight | 207.29 g/mol |
| IUPAC name | (6,6-dimethyloxan-2-yl)methanesulfonamide |
| InChIKey | WEWPFVFKNZUSLM-UHFFFAOYSA-N |
| SMILES | CC1(CCCC(O1)CS(=O)(=O)N)C |
Computed by PubChem (NCBI)