Products 2095411-21-3
CAS 2095411-21-3 is the registry number for 2-(2,6-Di-tert-butyl-4H-pyran-4-ylidene)propanedial. Offered by: Biosynth. Available pack sizes: 0,5g, 50mg.
2-(2,6-ditert-butylpyran-4-ylidene)propanedial (CAS 2095411-21-3) is a chemical compound with the molecular formula C16H22O3 and a molecular weight of 262.34 g/mol. IUPAC name: 2-(2,6-ditert-butylpyran-4-ylidene)propanedial. InChIKey: XLRORTAZJWVEIQ-UHFFFAOYSA-N.
| Molecular formula | C16H22O3 |
|---|---|
| Molecular weight | 262.34 g/mol |
| IUPAC name | 2-(2,6-ditert-butylpyran-4-ylidene)propanedial |
| InChIKey | XLRORTAZJWVEIQ-UHFFFAOYSA-N |
| SMILES | CC(C)(C)C1=CC(=C(C=O)C=O)C=C(O1)C(C)(C)C |
Computed by PubChem (NCBI)