Products 2095417-09-5
CAS 2095417-09-5 is the registry number for 1,N6-Etheno-ara-adenosine. Offered by: MedChemExpress. Available pack sizes: Get quote.
(2R,3S,4S,5R)-2-(hydroxymethyl)-5-imidazo[2,1-f]purin-3-yloxolane-3,4-diol (CAS 2095417-09-5) is a chemical compound with the molecular formula C12H13N5O4 and a molecular weight of 291.26 g/mol. IUPAC name: (2R,3S,4S,5R)-2-(hydroxymethyl)-5-imidazo[2,1-f]purin-3-yloxolane-3,4-diol. InChIKey: LRPBXXZUPUBCAP-QRKAXHLRSA-N.
| Molecular formula | C12H13N5O4 |
|---|---|
| Molecular weight | 291.26 g/mol |
| IUPAC name | (2R,3S,4S,5R)-2-(hydroxymethyl)-5-imidazo[2,1-f]purin-3-yloxolane-3,4-diol |
| InChIKey | LRPBXXZUPUBCAP-QRKAXHLRSA-N |
| SMILES | C1=CN2C=NC3=C(C2=N1)N=CN3[C@H]4[C@H]([C@@H]([C@H](O4)CO)O)O |
Computed by PubChem (NCBI)